C23H32O4 — CID 139782067
oxan-2-yl 2-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane-1-carboxylate (PubChem CID 139782067) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is oxan-2-yl 2-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane-1-carboxylate.
| Compound Name | oxan-2-yl 2-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane-1-carboxylate |
|---|---|
| PubChem CID | 139782067 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | oxan-2-yl 2-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane-1-carboxylate |
| SMILES | O=C(OC1CCCCO1)C12CC(C3C4CCC(C4)C31)C1C3CCC(C3)C12O |
| InChI | InChI=1S/C23H32O4/c24-21(27-17-3-1-2-8-26-17)22-11-16(18-12-4-5-13(9-12)20(18)22)19-14-6-7-15(10-14)23(19,22)25/h12-20,25H,1-11H2 |
| InChIKey | LCWCSCIGUCNTKW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|