C17H15FN2O3S — CID 139782261
3-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)imidazol-2-one (PubChem CID 139782261) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)imidazol-2-one.
| Compound Name | 3-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)imidazol-2-one |
|---|---|
| PubChem CID | 139782261 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)imidazol-2-one |
| SMILES | Cn1cc(-c2ccc(S(C)(=O)=O)cc2)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C17H15FN2O3S/c1-19-11-16(12-3-9-15(10-4-12)24(2,22)23)20(17(19)21)14-7-5-13(18)6-8-14/h3-11H,1-2H3 |
| InChIKey | JBORMXFLMPNUND-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |