C22H23FN2O5S — CID 123921078
2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethoxy]ethyl nitrite (PubChem CID 123921078) has the molecular formula C22H23FN2O5S and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethoxy]ethyl nitrite.
| Compound Name | 2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethoxy]ethyl nitrite |
|---|---|
| PubChem CID | 123921078 |
| Molecular Formula | C22H23FN2O5S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethoxy]ethyl nitrite |
| SMILES | Cc1c(CCOCCON=O)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O5S/c1-16-18(11-12-29-13-14-30-24-26)15-22(25(16)20-7-5-19(23)6-8-20)17-3-9-21(10-4-17)31(2,27)28/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | KCKRFMGVSZSURN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|