C22H22FN3O6S — CID 56929489
2-[[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]acetyl]amino]ethyl nitrate (PubChem CID 56929489) has the molecular formula C22H22FN3O6S and a molecular weight of 475.50 g/mol. Its IUPAC name is 2-[[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]acetyl]amino]ethyl nitrate.
| Compound Name | 2-[[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]acetyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 56929489 |
| Molecular Formula | C22H22FN3O6S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]acetyl]amino]ethyl nitrate |
| SMILES | Cc1c(CC(=O)NCCO[N+](=O)[O-])cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O6S/c1-15-17(14-22(27)24-11-12-32-26(28)29)13-21(25(15)19-7-5-18(23)6-8-19)16-3-9-20(10-4-16)33(2,30)31/h3-10,13H,11-12,14H2,1-2H3,(H,24,27) |
| InChIKey | IVQJGLCSKNJIAD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|