C20H21NO3S — CID 66693208
2-[2-methyl-5-(4-methylsulfonylphenyl)-1-phenylpyrrol-3-yl]ethanol (PubChem CID 66693208) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[2-methyl-5-(4-methylsulfonylphenyl)-1-phenylpyrrol-3-yl]ethanol.
| Compound Name | 2-[2-methyl-5-(4-methylsulfonylphenyl)-1-phenylpyrrol-3-yl]ethanol |
|---|---|
| PubChem CID | 66693208 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[2-methyl-5-(4-methylsulfonylphenyl)-1-phenylpyrrol-3-yl]ethanol |
| SMILES | Cc1c(CCO)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H21NO3S/c1-15-17(12-13-22)14-20(21(15)18-6-4-3-5-7-18)16-8-10-19(11-9-16)25(2,23)24/h3-11,14,22H,12-13H2,1-2H3 |
| InChIKey | BVQJAGNZOAELDE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|