C27H23F2NO4S — CID 68803049
4-fluoro-2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethyl]benzoic acid (PubChem CID 68803049) has the molecular formula C27H23F2NO4S and a molecular weight of 495.55 g/mol. Its IUPAC name is 4-fluoro-2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethyl]benzoic acid.
| Compound Name | 4-fluoro-2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68803049 |
| Molecular Formula | C27H23F2NO4S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 4-fluoro-2-[2-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethyl]benzoic acid |
| SMILES | Cc1c(CCc2cc(F)ccc2C(=O)O)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23F2NO4S/c1-17-19(3-4-20-15-22(29)9-14-25(20)27(31)32)16-26(30(17)23-10-7-21(28)8-11-23)18-5-12-24(13-6-18)35(2,33)34/h5-16H,3-4H2,1-2H3,(H,31,32) |
| InChIKey | CWYRPZVQBQGCDG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|