C25H21ClFNO3S — CID 10504537
3-[(4-chlorophenoxy)methyl]-1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrole (PubChem CID 10504537) has the molecular formula C25H21ClFNO3S and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrole.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrole |
|---|---|
| PubChem CID | 10504537 |
| Molecular Formula | C25H21ClFNO3S |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrole |
| SMILES | Cc1c(COc2ccc(Cl)cc2)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H21ClFNO3S/c1-17-19(16-31-23-11-5-20(26)6-12-23)15-25(28(17)22-9-7-21(27)8-10-22)18-3-13-24(14-4-18)32(2,29)30/h3-15H,16H2,1-2H3 |
| InChIKey | CMIBLDCMENOSKH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|