C23H25F2NO3S — CID 127025855
1-(3,4-difluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2-propoxyethyl)pyrrole (PubChem CID 127025855) has the molecular formula C23H25F2NO3S and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2-propoxyethyl)pyrrole.
| Compound Name | 1-(3,4-difluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2-propoxyethyl)pyrrole |
|---|---|
| PubChem CID | 127025855 |
| Molecular Formula | C23H25F2NO3S |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2-propoxyethyl)pyrrole |
| SMILES | CCCOCCc1cc(-c2ccc(S(C)(=O)=O)cc2)n(-c2ccc(F)c(F)c2)c1C |
| InChI | InChI=1S/C23H25F2NO3S/c1-4-12-29-13-11-18-14-23(17-5-8-20(9-6-17)30(3,27)28)26(16(18)2)19-7-10-21(24)22(25)15-19/h5-10,14-15H,4,11-13H2,1-3H3 |
| InChIKey | HTARZKYTCQVFSW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|