C28H24F3NO5S — CID 3739057
[2-methyl-5-(4-methylsulfonylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl 3-methoxybenzoate (PubChem CID 3739057) has the molecular formula C28H24F3NO5S and a molecular weight of 543.56 g/mol. Its IUPAC name is [2-methyl-5-(4-methylsulfonylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl 3-methoxybenzoate.
| Compound Name | [2-methyl-5-(4-methylsulfonylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl 3-methoxybenzoate |
|---|---|
| PubChem CID | 3739057 |
| Molecular Formula | C28H24F3NO5S |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | [2-methyl-5-(4-methylsulfonylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methyl 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCc2cc(-c3ccc(S(C)(=O)=O)cc3)n(-c3cccc(C(F)(F)F)c3)c2C)c1 |
| InChI | InChI=1S/C28H24F3NO5S/c1-18-21(17-37-27(33)20-6-4-9-24(14-20)36-2)15-26(19-10-12-25(13-11-19)38(3,34)35)32(18)23-8-5-7-22(16-23)28(29,30)31/h4-16H,17H2,1-3H3 |
| InChIKey | WTBMXKLIMQWYPL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|