C23H27FN2O4S — CID 118674029
1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-methoxyethoxy)ethanamine (PubChem CID 118674029) has the molecular formula C23H27FN2O4S and a molecular weight of 446.54 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-methoxyethoxy)ethanamine.
| Compound Name | 1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-methoxyethoxy)ethanamine |
|---|---|
| PubChem CID | 118674029 |
| Molecular Formula | C23H27FN2O4S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-methoxyethoxy)ethanamine |
| SMILES | COCCOCC(N)c1cc(-c2ccc(S(C)(=O)=O)cc2)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C23H27FN2O4S/c1-16-21(22(25)15-30-13-12-29-2)14-23(26(16)19-8-6-18(24)7-9-19)17-4-10-20(11-5-17)31(3,27)28/h4-11,14,22H,12-13,15,25H2,1-3H3 |
| InChIKey | HYCABLWUSOKOSB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|