C27H33FN2O6S — CID 66695911
tert-butyl N-[1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 66695911) has the molecular formula C27H33FN2O6S and a molecular weight of 532.63 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 66695911 |
| Molecular Formula | C27H33FN2O6S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | tert-butyl N-[1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]-2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | Cc1c(C(COCCO)NC(=O)OC(C)(C)C)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H33FN2O6S/c1-18-23(24(17-35-15-14-31)29-26(32)36-27(2,3)4)16-25(30(18)21-10-8-20(28)9-11-21)19-6-12-22(13-7-19)37(5,33)34/h6-13,16,24,31H,14-15,17H2,1-5H3,(H,29,32) |
| InChIKey | VOUKHVXZQCKAOC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|