C22H17F3N4OS — CID 139782614
N-[3-methyl-4-(1-methylimidazol-2-yl)sulfanylquinolin-8-yl]-2-(trifluoromethyl)benzamide (PubChem CID 139782614) has the molecular formula C22H17F3N4OS and a molecular weight of 442.47 g/mol. Its IUPAC name is N-[3-methyl-4-(1-methylimidazol-2-yl)sulfanylquinolin-8-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[3-methyl-4-(1-methylimidazol-2-yl)sulfanylquinolin-8-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139782614 |
| Molecular Formula | C22H17F3N4OS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[3-methyl-4-(1-methylimidazol-2-yl)sulfanylquinolin-8-yl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cnc2c(NC(=O)c3ccccc3C(F)(F)F)cccc2c1Sc1nccn1C |
| InChI | InChI=1S/C22H17F3N4OS/c1-13-12-27-18-15(19(13)31-21-26-10-11-29(21)2)7-5-9-17(18)28-20(30)14-6-3-4-8-16(14)22(23,24)25/h3-12H,1-2H3,(H,28,30) |
| InChIKey | NGNZIAKGXIEOEE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |