C18H15F3N4O — CID 19592320
N-(4-hydrazinyl-3-methylquinolin-8-yl)-2-(trifluoromethyl)benzamide (PubChem CID 19592320) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is N-(4-hydrazinyl-3-methylquinolin-8-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(4-hydrazinyl-3-methylquinolin-8-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 19592320 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-(4-hydrazinyl-3-methylquinolin-8-yl)-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cnc2c(NC(=O)c3ccccc3C(F)(F)F)cccc2c1NN |
| InChI | InChI=1S/C18H15F3N4O/c1-10-9-23-16-12(15(10)25-22)6-4-8-14(16)24-17(26)11-5-2-3-7-13(11)18(19,20)21/h2-9H,22H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | UWCSVKCPPYZITK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|