C25H19F3N4O2 — CID 139782331
N-[4-(2-benzoylhydrazinyl)-3-methylquinolin-8-yl]-2-(trifluoromethyl)benzamide (PubChem CID 139782331) has the molecular formula C25H19F3N4O2 and a molecular weight of 464.45 g/mol. Its IUPAC name is N-[4-(2-benzoylhydrazinyl)-3-methylquinolin-8-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(2-benzoylhydrazinyl)-3-methylquinolin-8-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139782331 |
| Molecular Formula | C25H19F3N4O2 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[4-(2-benzoylhydrazinyl)-3-methylquinolin-8-yl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cnc2c(NC(=O)c3ccccc3C(F)(F)F)cccc2c1NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H19F3N4O2/c1-15-14-29-22-18(21(15)31-32-23(33)16-8-3-2-4-9-16)11-7-13-20(22)30-24(34)17-10-5-6-12-19(17)25(26,27)28/h2-14H,1H3,(H,29,31)(H,30,34)(H,32,33) |
| InChIKey | PLESJEUTUFSNON-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|