C14H12O6 — CID 139783788
[2-(2-methylprop-2-enoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylprop-2-enoate (PubChem CID 139783788) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139783788 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=C(OC(=O)C(=C)C)C(=O)C=CC1=O |
| InChI | InChI=1S/C14H12O6/c1-7(2)13(17)19-11-9(15)5-6-10(16)12(11)20-14(18)8(3)4/h5-6H,1,3H2,2,4H3 |
| InChIKey | VWXYNZZNDMCAFT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|