C36H29F3O5S2 — CID 139785753
[[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139785753) has the molecular formula C36H29F3O5S2 and a molecular weight of 662.75 g/mol. Its IUPAC name is [[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139785753 |
| Molecular Formula | C36H29F3O5S2 |
| Molecular Weight | 662.75 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | [[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1OCOCCc1cc2ccccc2c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C36H29F3O5S2/c37-36(38,39)46(40,41)44-45(29-14-3-1-4-15-29,30-16-5-2-6-17-30)35-22-12-11-21-34(35)43-26-42-24-23-28-25-27-13-7-8-18-31(27)33-20-10-9-19-32(28)33/h1-22,25H,23-24,26H2 |
| InChIKey | KHCXAGRBDJLPSN-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.75 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|