C52H61F3O9S2 — CID 139785770
[bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139785770) has the molecular formula C52H61F3O9S2 and a molecular weight of 951.18 g/mol. Its IUPAC name is [bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139785770 |
| Molecular Formula | C52H61F3O9S2 |
| Molecular Weight | 951.18 g/mol |
| Exact Mass | 950.37 |
| IUPAC Name | [bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(OC(C)(C)C)c(OC(C)(C)C)c2)c2ccccc2OCOCCc2cc3ccccc3c3ccccc23)cc1OC(C)(C)C |
| InChI | InChI=1S/C52H61F3O9S2/c1-48(2,3)60-42-27-25-37(32-45(42)62-50(7,8)9)65(64-66(56,57)52(53,54)55,38-26-28-43(61-49(4,5)6)46(33-38)63-51(10,11)12)47-24-18-17-23-44(47)59-34-58-30-29-36-31-35-19-13-14-20-39(35)41-22-16-15-21-40(36)41/h13-28,31-33H,29-30,34H2,1-12H3 |
| InChIKey | FMNZYOZWADIABL-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.18 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|