C53H57F9O8S2 — CID 139785784
[bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139785784) has the molecular formula C53H57F9O8S2 and a molecular weight of 1057.15 g/mol. Its IUPAC name is [bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139785784 |
| Molecular Formula | C53H57F9O8S2 |
| Molecular Weight | 1057.15 g/mol |
| Exact Mass | 1056.34 |
| IUPAC Name | [bis[3,4-bis[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)Oc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(OCc3cc4ccccc4c4ccccc34)cc2)c2ccc(OC(C)(C)C)c(OC(C)(C)C)c2)cc1OC(C)(C)C |
| InChI | InChI=1S/C53H57F9O8S2/c1-46(2,3)66-42-27-25-37(30-44(42)68-48(7,8)9)71(38-26-28-43(67-47(4,5)6)45(31-38)69-49(10,11)12,70-72(63,64)53(61,62)51(56,57)50(54,55)52(58,59)60)36-23-21-35(22-24-36)65-32-34-29-33-17-13-14-18-39(33)41-20-16-15-19-40(34)41/h13-31H,32H2,1-12H3 |
| InChIKey | GTNQOAKUHBCVGT-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.15 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|