C18H26ClF3Si — CID 139789212
1-chloro-1-pentyl-4-[2-(3,4,5-trifluorophenyl)ethyl]silinane (PubChem CID 139789212) has the molecular formula C18H26ClF3Si and a molecular weight of 362.94 g/mol. Its IUPAC name is 1-chloro-1-pentyl-4-[2-(3,4,5-trifluorophenyl)ethyl]silinane.
| Compound Name | 1-chloro-1-pentyl-4-[2-(3,4,5-trifluorophenyl)ethyl]silinane |
|---|---|
| PubChem CID | 139789212 |
| Molecular Formula | C18H26ClF3Si |
| Molecular Weight | 362.94 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-chloro-1-pentyl-4-[2-(3,4,5-trifluorophenyl)ethyl]silinane |
| SMILES | CCCCC[Si]1(Cl)CCC(CCc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H26ClF3Si/c1-2-3-4-9-23(19)10-7-14(8-11-23)5-6-15-12-16(20)18(22)17(21)13-15/h12-14H,2-11H2,1H3 |
| InChIKey | PROBWMLAYZNRER-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.94 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|