About 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline
2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline (PubChem CID 139791749) has the molecular formula C17H22N4O3
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline.
Molecular Properties
| Compound Name | 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline |
| PubChem CID | 139791749 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline |
| SMILES | COc1cc(OC)nc(C(c2ccccc2N)N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22N4O3/c1-22-14-11-15(23-2)20-17(19-14)16(21-7-9-24-10-8-21)12-5-3-4-6-13(12)18/h3-6,11,16H,7-10,18H2,1-2H3 |
| InChIKey | VIEKDUNEOHDBDM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline?
The IUPAC name of 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline (CID 139791749) is 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline.
What is the SMILES notation for 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline?
The canonical SMILES for 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline is COc1cc(OC)nc(C(c2ccccc2N)N2CCOCC2)n1.
What is the InChIKey of 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline?
The InChIKey is VIEKDUNEOHDBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O3/c1-22-14-11-15(23-2)20-17(19-14)16(21-7-9-24-10-8-21)12-5-3-4-6-13(12)18/h3-6,11,16H,7-10,18H2,1-2H3.
What are the key properties of 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline?
2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline has a molecular weight of 330.39 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethoxypyrimidin-2-yl)-morpholin-4-ylmethyl]aniline is sourced from PubChem (CID 139791749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).