C13H8O11S — CID 139792832
7,8-dihydroxy-4-sulfonaphthalene-1,2,3-tricarboxylic acid (PubChem CID 139792832) has the molecular formula C13H8O11S and a molecular weight of 372.26 g/mol. Its IUPAC name is 7,8-dihydroxy-4-sulfonaphthalene-1,2,3-tricarboxylic acid.
| Compound Name | 7,8-dihydroxy-4-sulfonaphthalene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 139792832 |
| Molecular Formula | C13H8O11S |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 7,8-dihydroxy-4-sulfonaphthalene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)c1c(C(=O)O)c(C(=O)O)c2c(O)c(O)ccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C13H8O11S/c14-4-2-1-3-5(9(4)15)6(11(16)17)7(12(18)19)8(13(20)21)10(3)25(22,23)24/h1-2,14-15H,(H,16,17)(H,18,19)(H,20,21)(H,22,23,24) |
| InChIKey | WZEPNISXDVJHND-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|