C14H10O6 — CID 70211962
5,6-dihydroxy-1,2-dihydrocyclobuta[a]naphthalene-3,4-dicarboxylic acid (PubChem CID 70211962) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5,6-dihydroxy-1,2-dihydrocyclobuta[a]naphthalene-3,4-dicarboxylic acid.
| Compound Name | 5,6-dihydroxy-1,2-dihydrocyclobuta[a]naphthalene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 70211962 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5,6-dihydroxy-1,2-dihydrocyclobuta[a]naphthalene-3,4-dicarboxylic acid |
| SMILES | O=C(O)c1c2c(c3ccc(O)c(O)c3c1C(=O)O)CC2 |
| InChI | InChI=1S/C14H10O6/c15-8-4-3-6-5-1-2-7(5)10(13(17)18)11(14(19)20)9(6)12(8)16/h3-4,15-16H,1-2H2,(H,17,18)(H,19,20) |
| InChIKey | BMWKICBRPULUDO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|