C10H8O4 — CID 55297492
4-hydroxy-1-oxo-2,3-dihydroindene-5-carboxylic acid (PubChem CID 55297492) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 4-hydroxy-1-oxo-2,3-dihydroindene-5-carboxylic acid.
| Compound Name | 4-hydroxy-1-oxo-2,3-dihydroindene-5-carboxylic acid |
|---|---|
| PubChem CID | 55297492 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 4-hydroxy-1-oxo-2,3-dihydroindene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1O)CCC2=O |
| InChI | InChI=1S/C10H8O4/c11-8-4-3-6-5(8)1-2-7(9(6)12)10(13)14/h1-2,12H,3-4H2,(H,13,14) |
| InChIKey | IDOPTJCEJMQNDW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |