C29H24O3 — CID 174408261
1-hydroxynaphthalene-2-carboxylic acid;1,2,11,12-tetrahydrochrysene (PubChem CID 174408261) has the molecular formula C29H24O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-hydroxynaphthalene-2-carboxylic acid;1,2,11,12-tetrahydrochrysene.
| Compound Name | 1-hydroxynaphthalene-2-carboxylic acid;1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174408261 |
| Molecular Formula | C29H24O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-hydroxynaphthalene-2-carboxylic acid;1,2,11,12-tetrahydrochrysene |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2ccccc12.O=C(O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C18H16.C11H8O3/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1,3-5,7-9,11H,2,6,10,12H2;1-6,12H,(H,13,14) |
| InChIKey | JHSFDYCOOJOVHP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |