C26H24Cl2N2 — CID 174697585
1,7-naphthyridine;1,2,11,12-tetrahydrochrysene;dihydrochloride (PubChem CID 174697585) has the molecular formula C26H24Cl2N2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 1,7-naphthyridine;1,2,11,12-tetrahydrochrysene;dihydrochloride.
| Compound Name | 1,7-naphthyridine;1,2,11,12-tetrahydrochrysene;dihydrochloride |
|---|---|
| PubChem CID | 174697585 |
| Molecular Formula | C26H24Cl2N2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1,7-naphthyridine;1,2,11,12-tetrahydrochrysene;dihydrochloride |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2ccccc12.Cl.Cl.c1cnc2cnccc2c1 |
| InChI | InChI=1S/C18H16.C8H6N2.2ClH/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-7-3-5-9-6-8(7)10-4-1;;/h1,3-5,7-9,11H,2,6,10,12H2;1-6H;2*1H |
| InChIKey | QRZPKZDRLIPJLS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |