C21H21NO — CID 174610668
4,5-dihydro-1,3-oxazole;1,2,11,12-tetrahydrochrysene (PubChem CID 174610668) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;1,2,11,12-tetrahydrochrysene.
| Compound Name | 4,5-dihydro-1,3-oxazole;1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174610668 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;1,2,11,12-tetrahydrochrysene |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2ccccc12.C1=NCCO1 |
| InChI | InChI=1S/C18H16.C3H5NO/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-5-3-4-1/h1,3-5,7-9,11H,2,6,10,12H2;3H,1-2H2 |
| InChIKey | WPJWWNGNLMXXPD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |