C31H26N2O — CID 174435741
benzo[e]benzimidazol-2-one;7-ethyl-1,2,11,12-tetrahydrochrysene (PubChem CID 174435741) has the molecular formula C31H26N2O and a molecular weight of 442.56 g/mol. Its IUPAC name is benzo[e]benzimidazol-2-one;7-ethyl-1,2,11,12-tetrahydrochrysene.
| Compound Name | benzo[e]benzimidazol-2-one;7-ethyl-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174435741 |
| Molecular Formula | C31H26N2O |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | benzo[e]benzimidazol-2-one;7-ethyl-1,2,11,12-tetrahydrochrysene |
| SMILES | CCc1cccc2c3c(ccc12)C1=C(CCC=C1)CC3.O=C1N=c2ccc3ccccc3c2=N1 |
| InChI | InChI=1S/C20H20.C11H6N2O/c1-2-14-7-5-9-18-17(14)12-13-19-16-8-4-3-6-15(16)10-11-20(18)19;14-11-12-9-6-5-7-3-1-2-4-8(7)10(9)13-11/h4-5,7-9,12-13H,2-3,6,10-11H2,1H3;1-6H |
| InChIKey | QFUHRDFQOCXDID-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |