C29H22N2O — CID 174378285
benzo[e]benzimidazol-2-one;1,2,11,12-tetrahydrochrysene (PubChem CID 174378285) has the molecular formula C29H22N2O and a molecular weight of 414.51 g/mol. Its IUPAC name is benzo[e]benzimidazol-2-one;1,2,11,12-tetrahydrochrysene.
| Compound Name | benzo[e]benzimidazol-2-one;1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174378285 |
| Molecular Formula | C29H22N2O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | benzo[e]benzimidazol-2-one;1,2,11,12-tetrahydrochrysene |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2ccccc12.O=C1N=c2ccc3ccccc3c2=N1 |
| InChI | InChI=1S/C18H16.C11H6N2O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;14-11-12-9-6-5-7-3-1-2-4-8(7)10(9)13-11/h1,3-5,7-9,11H,2,6,10,12H2;1-6H |
| InChIKey | AJXFZDLYRFLAPA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |