C26H23ClN2 — CID 174712744
1,6-naphthyridine;1,2,11,12-tetrahydrochrysene;hydrochloride (PubChem CID 174712744) has the molecular formula C26H23ClN2 and a molecular weight of 398.94 g/mol. Its IUPAC name is 1,6-naphthyridine;1,2,11,12-tetrahydrochrysene;hydrochloride.
| Compound Name | 1,6-naphthyridine;1,2,11,12-tetrahydrochrysene;hydrochloride |
|---|---|
| PubChem CID | 174712744 |
| Molecular Formula | C26H23ClN2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1,6-naphthyridine;1,2,11,12-tetrahydrochrysene;hydrochloride |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2ccccc12.Cl.c1cnc2ccncc2c1 |
| InChI | InChI=1S/C18H16.C8H6N2.ClH/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-7-6-9-5-3-8(7)10-4-1;/h1,3-5,7-9,11H,2,6,10,12H2;1-6H;1H |
| InChIKey | VESCAANSDNJVCY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |