C33H34O2 — CID 174400538
1,2,11,12-tetrahydrochrysene;5,5,8,8-tetramethylnaphthalene-2-carboxylic acid (PubChem CID 174400538) has the molecular formula C33H34O2 and a molecular weight of 462.63 g/mol. Its IUPAC name is 1,2,11,12-tetrahydrochrysene;5,5,8,8-tetramethylnaphthalene-2-carboxylic acid.
| Compound Name | 1,2,11,12-tetrahydrochrysene;5,5,8,8-tetramethylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 174400538 |
| Molecular Formula | C33H34O2 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1,2,11,12-tetrahydrochrysene;5,5,8,8-tetramethylnaphthalene-2-carboxylic acid |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2ccccc12.CC1(C)C=CC(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C18H16.C15H18O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-14(2)7-8-15(3,4)12-9-10(13(16)17)5-6-11(12)14/h1,3-5,7-9,11H,2,6,10,12H2;5-9H,1-4H3,(H,16,17) |
| InChIKey | ZCOOEYFCYYFSSD-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|