methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate

C12H12O3 — CID 20687962

IUPACmethyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1C)CCC2=O
InChIInChI=1S/C12H12O3/c1-7-8-5-6-11(13)10(8)4-3-9(7)12(14)15-2/h3-4H,5-6H2,1-2H3
InChIKeyFSYVTPBTQVOOFR-UHFFFAOYSA-N
MW204.22 g/mol
LogP1.91
Rot. Bonds1

About methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate

methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate (PubChem CID 20687962) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate.

Molecular Properties

Compound Namemethyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate
PubChem CID20687962
Molecular FormulaC12H12O3
Molecular Weight204.22 g/mol
Exact Mass204.08
IUPAC Namemethyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1C)CCC2=O
InChIInChI=1S/C12H12O3/c1-7-8-5-6-11(13)10(8)4-3-9(7)12(14)15-2/h3-4H,5-6H2,1-2H3
InChIKeyFSYVTPBTQVOOFR-UHFFFAOYSA-N
XLogP1.91
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.22
LogP ≤ 51.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate?
The IUPAC name of methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate (CID 20687962) is methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate.
What is the SMILES notation for methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate?
The canonical SMILES for methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate is COC(=O)c1ccc2c(c1C)CCC2=O.
What is the InChIKey of methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate?
The InChIKey is FSYVTPBTQVOOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-7-8-5-6-11(13)10(8)4-3-9(7)12(14)15-2/h3-4H,5-6H2,1-2H3.
What are the key properties of methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate?
methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate has a molecular weight of 204.22 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-1-oxo-2,3-dihydroindene-5-carboxylate is sourced from PubChem (CID 20687962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).