C20H24O8 — CID 139628561
dimethyl 3,12-dioxo-2,13-dioxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15,18-dicarboxylate (PubChem CID 139628561) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is dimethyl 3,12-dioxo-2,13-dioxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15,18-dicarboxylate.
| Compound Name | dimethyl 3,12-dioxo-2,13-dioxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15,18-dicarboxylate |
|---|---|
| PubChem CID | 139628561 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | dimethyl 3,12-dioxo-2,13-dioxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15,18-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c2c1OC(=O)CCCCCCCCC(=O)O2 |
| InChI | InChI=1S/C20H24O8/c1-25-19(23)13-11-12-14(20(24)26-2)18-17(13)27-15(21)9-7-5-3-4-6-8-10-16(22)28-18/h11-12H,3-10H2,1-2H3 |
| InChIKey | IFEJUXXOJDCNOD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|