C28H36O4 — CID 44725366
dimethyl tricyclo[16.2.2.28,11]tetracosa-1(20),8,10,18,21,23-hexaene-9,19-dicarboxylate (PubChem CID 44725366) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is dimethyl tricyclo[16.2.2.28,11]tetracosa-1(20),8,10,18,21,23-hexaene-9,19-dicarboxylate.
| Compound Name | dimethyl tricyclo[16.2.2.28,11]tetracosa-1(20),8,10,18,21,23-hexaene-9,19-dicarboxylate |
|---|---|
| PubChem CID | 44725366 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | dimethyl tricyclo[16.2.2.28,11]tetracosa-1(20),8,10,18,21,23-hexaene-9,19-dicarboxylate |
| SMILES | COC(=O)c1cc2ccc1CCCCCCc1ccc(c(C(=O)OC)c1)CCCCCC2 |
| InChI | InChI=1S/C28H36O4/c1-31-27(29)25-19-21-11-7-4-6-10-14-24-18-16-22(20-26(24)28(30)32-2)12-8-3-5-9-13-23(25)17-15-21/h15-20H,3-14H2,1-2H3 |
| InChIKey | BGXGAGXVORVNSU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |