C25H22O4 — CID 633563
dimethyl tetracyclo[13.2.2.28,11.02,7]henicosa-1(17),2,4,6,8(21),9,11(20),15,18-nonaene-4,5-dicarboxylate (PubChem CID 633563) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is dimethyl tetracyclo[13.2.2.28,11.02,7]henicosa-1(17),2,4,6,8(21),9,11(20),15,18-nonaene-4,5-dicarboxylate.
| Compound Name | dimethyl tetracyclo[13.2.2.28,11.02,7]henicosa-1(17),2,4,6,8(21),9,11(20),15,18-nonaene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 633563 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | dimethyl tetracyclo[13.2.2.28,11.02,7]henicosa-1(17),2,4,6,8(21),9,11(20),15,18-nonaene-4,5-dicarboxylate |
| SMILES | COC(=O)c1cc2c(cc1C(=O)OC)-c1ccc(cc1)CCCc1ccc-2cc1 |
| InChI | InChI=1S/C25H22O4/c1-28-24(26)22-14-20-18-10-6-16(7-11-18)4-3-5-17-8-12-19(13-9-17)21(20)15-23(22)25(27)29-2/h6-15H,3-5H2,1-2H3 |
| InChIKey | GARVCOPGJUSPNU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |