C17H14O6S — CID 31771332
methyl 3-[(1-oxo-2,3-dihydroinden-4-yl)oxysulfonyl]benzoate (PubChem CID 31771332) has the molecular formula C17H14O6S and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl 3-[(1-oxo-2,3-dihydroinden-4-yl)oxysulfonyl]benzoate.
| Compound Name | methyl 3-[(1-oxo-2,3-dihydroinden-4-yl)oxysulfonyl]benzoate |
|---|---|
| PubChem CID | 31771332 |
| Molecular Formula | C17H14O6S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | methyl 3-[(1-oxo-2,3-dihydroinden-4-yl)oxysulfonyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Oc2cccc3c2CCC3=O)c1 |
| InChI | InChI=1S/C17H14O6S/c1-22-17(19)11-4-2-5-12(10-11)24(20,21)23-16-7-3-6-13-14(16)8-9-15(13)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | XOFQSYHURPITBH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|