C23H39NO5S — CID 139793483
2-hexoxy-2-(5-methoxyoctan-4-ylsulfonyl)-N-phenylacetamide (PubChem CID 139793483) has the molecular formula C23H39NO5S and a molecular weight of 441.63 g/mol. Its IUPAC name is 2-hexoxy-2-(5-methoxyoctan-4-ylsulfonyl)-N-phenylacetamide.
| Compound Name | 2-hexoxy-2-(5-methoxyoctan-4-ylsulfonyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 139793483 |
| Molecular Formula | C23H39NO5S |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-hexoxy-2-(5-methoxyoctan-4-ylsulfonyl)-N-phenylacetamide |
| SMILES | CCCCCCOC(C(=O)Nc1ccccc1)S(=O)(=O)C(CCC)C(CCC)OC |
| InChI | InChI=1S/C23H39NO5S/c1-5-8-9-13-18-29-23(22(25)24-19-16-11-10-12-17-19)30(26,27)21(15-7-3)20(28-4)14-6-2/h10-12,16-17,20-21,23H,5-9,13-15,18H2,1-4H3,(H,24,25) |
| InChIKey | IGBVMMIGKNUOCT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|