C18H29NO3 — CID 91612582
2,4-dihydroxy-N-phenyldodecanamide (PubChem CID 91612582) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 2,4-dihydroxy-N-phenyldodecanamide.
| Compound Name | 2,4-dihydroxy-N-phenyldodecanamide |
|---|---|
| PubChem CID | 91612582 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2,4-dihydroxy-N-phenyldodecanamide |
| SMILES | CCCCCCCCC(O)CC(O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H29NO3/c1-2-3-4-5-6-10-13-16(20)14-17(21)18(22)19-15-11-8-7-9-12-15/h7-9,11-12,16-17,20-21H,2-6,10,13-14H2,1H3,(H,19,22) |
| InChIKey | CBNGGBREIMZVBI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|