C19H17Cl2F3N4O2 — CID 139797439
2,6-dichloro-N-[3-[(3-hydroxypropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]benzamide (PubChem CID 139797439) has the molecular formula C19H17Cl2F3N4O2 and a molecular weight of 461.27 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-[(3-hydroxypropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[3-[(3-hydroxypropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]benzamide |
|---|---|
| PubChem CID | 139797439 |
| Molecular Formula | C19H17Cl2F3N4O2 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2,6-dichloro-N-[3-[(3-hydroxypropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]benzamide |
| SMILES | O=C(Nc1cccn2c(CNCCCO)c(C(F)(F)F)nc12)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H17Cl2F3N4O2/c20-11-4-1-5-12(21)15(11)18(30)26-13-6-2-8-28-14(10-25-7-3-9-29)16(19(22,23)24)27-17(13)28/h1-2,4-6,8,25,29H,3,7,9-10H2,(H,26,30) |
| InChIKey | PYGOULMKZCGHJC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|