C19H16BrCl2F3N4O — CID 139797440
N-[3-[(3-bromopropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide (PubChem CID 139797440) has the molecular formula C19H16BrCl2F3N4O and a molecular weight of 524.17 g/mol. Its IUPAC name is N-[3-[(3-bromopropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[3-[(3-bromopropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 139797440 |
| Molecular Formula | C19H16BrCl2F3N4O |
| Molecular Weight | 524.17 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | N-[3-[(3-bromopropylamino)methyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide |
| SMILES | O=C(Nc1cccn2c(CNCCCBr)c(C(F)(F)F)nc12)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H16BrCl2F3N4O/c20-7-3-8-26-10-14-16(19(23,24)25)28-17-13(6-2-9-29(14)17)27-18(30)15-11(21)4-1-5-12(15)22/h1-2,4-6,9,26H,3,7-8,10H2,(H,27,30) |
| InChIKey | HAOYKIXCOSQDJF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.17 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|