About N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide
N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide (PubChem CID 54256907) has the molecular formula C21H13Cl2F3N4O
and a molecular weight of 465.26 g/mol. Its IUPAC name is N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide |
| PubChem CID | 54256907 |
| Molecular Formula | C21H13Cl2F3N4O |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide |
| SMILES | Nc1cccc(-c2c(C(F)(F)F)nc3c(NC(=O)c4c(Cl)cccc4Cl)cccn23)c1 |
| InChI | InChI=1S/C21H13Cl2F3N4O/c22-13-6-2-7-14(23)16(13)20(31)28-15-8-3-9-30-17(11-4-1-5-12(27)10-11)18(21(24,25)26)29-19(15)30/h1-10H,27H2,(H,28,31) |
| InChIKey | RASDLXIRTAWUJY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide?
The IUPAC name of N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide (CID 54256907) is N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide.
What is the SMILES notation for N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide?
The canonical SMILES for N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide is Nc1cccc(-c2c(C(F)(F)F)nc3c(NC(=O)c4c(Cl)cccc4Cl)cccn23)c1.
What is the InChIKey of N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide?
The InChIKey is RASDLXIRTAWUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl2F3N4O/c22-13-6-2-7-14(23)16(13)20(31)28-15-8-3-9-30-17(11-4-1-5-12(27)10-11)18(21(24,25)26)29-19(15)30/h1-10H,27H2,(H,28,31).
What are the key properties of N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide?
N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide has a molecular weight of 465.26 g/mol, XLogP of 6.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide is sourced from PubChem (CID 54256907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).