C21H13Cl2F3N4O — CID 54256907
N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide (PubChem CID 54256907) has the molecular formula C21H13Cl2F3N4O and a molecular weight of 465.26 g/mol. Its IUPAC name is N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 54256907 |
| Molecular Formula | C21H13Cl2F3N4O |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[3-(3-aminophenyl)-2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]-2,6-dichlorobenzamide |
| SMILES | Nc1cccc(-c2c(C(F)(F)F)nc3c(NC(=O)c4c(Cl)cccc4Cl)cccn23)c1 |
| InChI | InChI=1S/C21H13Cl2F3N4O/c22-13-6-2-7-14(23)16(13)20(31)28-15-8-3-9-30-17(11-4-1-5-12(27)10-11)18(21(24,25)26)29-19(15)30/h1-10H,27H2,(H,28,31) |
| InChIKey | RASDLXIRTAWUJY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|