C18H22N6O7S — CID 139798839
2-(benzenesulfonamido)-3-[[3-[1-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-1,2-oxazole-5-carbonyl]amino]propanoic acid (PubChem CID 139798839) has the molecular formula C18H22N6O7S and a molecular weight of 466.48 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[[3-[1-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-1,2-oxazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 2-(benzenesulfonamido)-3-[[3-[1-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-1,2-oxazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139798839 |
| Molecular Formula | C18H22N6O7S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[[3-[1-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-1,2-oxazole-5-carbonyl]amino]propanoic acid |
| SMILES | CC(NC1=NCCN1)Oc1cc(C(=O)NCC(NS(=O)(=O)c2ccccc2)C(=O)O)on1 |
| InChI | InChI=1S/C18H22N6O7S/c1-11(22-18-19-7-8-20-18)30-15-9-14(31-23-15)16(25)21-10-13(17(26)27)24-32(28,29)12-5-3-2-4-6-12/h2-6,9,11,13,24H,7-8,10H2,1H3,(H,21,25)(H,26,27)(H2,19,20,22) |
| InChIKey | NYKYYWCWLAAGAZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 184.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|