C30H33N7O5S — CID 67661858
1-(4,5-dihydro-1H-imidazol-2-ylamino)butyl 3-(1H-indazole-7-carbonylamino)-2-[(4-phenylphenyl)sulfonylamino]propanoate (PubChem CID 67661858) has the molecular formula C30H33N7O5S and a molecular weight of 603.71 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylamino)butyl 3-(1H-indazole-7-carbonylamino)-2-[(4-phenylphenyl)sulfonylamino]propanoate.
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylamino)butyl 3-(1H-indazole-7-carbonylamino)-2-[(4-phenylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 67661858 |
| Molecular Formula | C30H33N7O5S |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylamino)butyl 3-(1H-indazole-7-carbonylamino)-2-[(4-phenylphenyl)sulfonylamino]propanoate |
| SMILES | CCCC(NC1=NCCN1)OC(=O)C(CNC(=O)c1cccc2cn[nH]c12)NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33N7O5S/c1-2-7-26(35-30-31-16-17-32-30)42-29(39)25(19-33-28(38)24-11-6-10-22-18-34-36-27(22)24)37-43(40,41)23-14-12-21(13-15-23)20-8-4-3-5-9-20/h3-6,8-15,18,25-26,37H,2,7,16-17,19H2,1H3,(H,33,38)(H,34,36)(H2,31,32,35) |
| InChIKey | ZHGURKNRPGAAOA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|