C26H26Cl2N6O5S — CID 67661903
1-(pyridin-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-6-carbonylamino)propanoate (PubChem CID 67661903) has the molecular formula C26H26Cl2N6O5S and a molecular weight of 605.50 g/mol. Its IUPAC name is 1-(pyridin-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-6-carbonylamino)propanoate.
| Compound Name | 1-(pyridin-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-6-carbonylamino)propanoate |
|---|---|
| PubChem CID | 67661903 |
| Molecular Formula | C26H26Cl2N6O5S |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | 1-(pyridin-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-6-carbonylamino)propanoate |
| SMILES | CCCC(Nc1ccccn1)OC(=O)C(CNC(=O)c1ccc2cn[nH]c2c1)NS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H26Cl2N6O5S/c1-2-6-23(32-22-9-3-4-12-29-22)39-26(36)21(34-40(37,38)24-18(27)7-5-8-19(24)28)15-30-25(35)16-10-11-17-14-31-33-20(17)13-16/h3-5,7-14,21,23,34H,2,6,15H2,1H3,(H,29,32)(H,30,35)(H,31,33) |
| InChIKey | NQUPDMCYQOXNQJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|