C24H25Cl2N7O5S — CID 67662009
1-(1H-imidazol-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-7-carbonylamino)propanoate (PubChem CID 67662009) has the molecular formula C24H25Cl2N7O5S and a molecular weight of 594.48 g/mol. Its IUPAC name is 1-(1H-imidazol-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-7-carbonylamino)propanoate.
| Compound Name | 1-(1H-imidazol-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-7-carbonylamino)propanoate |
|---|---|
| PubChem CID | 67662009 |
| Molecular Formula | C24H25Cl2N7O5S |
| Molecular Weight | 594.48 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | 1-(1H-imidazol-2-ylamino)butyl 2-[(2,6-dichlorophenyl)sulfonylamino]-3-(1H-indazole-7-carbonylamino)propanoate |
| SMILES | CCCC(Nc1ncc[nH]1)OC(=O)C(CNC(=O)c1cccc2cn[nH]c12)NS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H25Cl2N7O5S/c1-2-5-19(31-24-27-10-11-28-24)38-23(35)18(33-39(36,37)21-16(25)8-4-9-17(21)26)13-29-22(34)15-7-3-6-14-12-30-32-20(14)15/h3-4,6-12,18-19,33H,2,5,13H2,1H3,(H,29,34)(H,30,32)(H2,27,28,31) |
| InChIKey | WQIKCPDFIZEMHD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|