C28H35ClN4O5 — CID 139800711
methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(piperidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride (PubChem CID 139800711) has the molecular formula C28H35ClN4O5 and a molecular weight of 543.06 g/mol. Its IUPAC name is methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(piperidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride.
| Compound Name | methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(piperidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 139800711 |
| Molecular Formula | C28H35ClN4O5 |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(piperidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C(C)[C@](C)(C(=O)OC)C(=O)N3C(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H34N4O5.ClH/c1-18-23(17-37-22-13-11-20(12-14-22)19-7-9-21(10-8-19)24(29)30)32(25(33)28(18,2)26(34)36-3)27(35)31-15-5-4-6-16-31;/h7-14,18,23H,4-6,15-17H2,1-3H3,(H3,29,30);1H/t18?,23-,28+;/m1./s1 |
| InChIKey | OWIHQSUHIISEMA-LQGGROOWSA-N |
| XLogP | 4.07 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|