C27H33ClN4O5 — CID 139800749
methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(pyrrolidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride (PubChem CID 139800749) has the molecular formula C27H33ClN4O5 and a molecular weight of 529.04 g/mol. Its IUPAC name is methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(pyrrolidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride.
| Compound Name | methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(pyrrolidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 139800749 |
| Molecular Formula | C27H33ClN4O5 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | methyl (3S,5S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-3,4-dimethyl-2-oxo-1-(pyrrolidine-1-carbonyl)pyrrolidine-3-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C(C)[C@](C)(C(=O)OC)C(=O)N3C(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O5.ClH/c1-17-22(31(26(34)30-14-4-5-15-30)24(32)27(17,2)25(33)35-3)16-36-21-12-10-19(11-13-21)18-6-8-20(9-7-18)23(28)29;/h6-13,17,22H,4-5,14-16H2,1-3H3,(H3,28,29);1H/t17?,22-,27+;/m1./s1 |
| InChIKey | RTWCCAOSRFFJKA-FMIYGLBASA-N |
| XLogP | 3.68 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|