C29H32ClN5O4 — CID 139801447
N-[2-[4-(2-chlorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide (PubChem CID 139801447) has the molecular formula C29H32ClN5O4 and a molecular weight of 550.06 g/mol. Its IUPAC name is N-[2-[4-(2-chlorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide.
| Compound Name | N-[2-[4-(2-chlorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 139801447 |
| Molecular Formula | C29H32ClN5O4 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | N-[2-[4-(2-chlorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
| SMILES | Cn1nc2c(c1N(CCN1CCC(C(=O)c3ccccc3Cl)CC1)C(=O)c1ccc([N+](=O)[O-])cc1)CCCC2 |
| InChI | InChI=1S/C29H32ClN5O4/c1-32-28(24-7-3-5-9-26(24)31-32)34(29(37)21-10-12-22(13-11-21)35(38)39)19-18-33-16-14-20(15-17-33)27(36)23-6-2-4-8-25(23)30/h2,4,6,8,10-13,20H,3,5,7,9,14-19H2,1H3 |
| InChIKey | OINQUOAMFTYPKG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|