C29H30FN5O4 — CID 139801484
N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide (PubChem CID 139801484) has the molecular formula C29H30FN5O4 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide.
| Compound Name | N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide |
|---|---|
| PubChem CID | 139801484 |
| Molecular Formula | C29H30FN5O4 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ncnc3c2CCCC3)CC1 |
| InChI | InChI=1S/C29H30FN5O4/c30-23-9-5-20(6-10-23)27(36)21-13-15-33(16-14-21)17-18-34(28-25-3-1-2-4-26(25)31-19-32-28)29(37)22-7-11-24(12-8-22)35(38)39/h5-12,19,21H,1-4,13-18H2 |
| InChIKey | QILTZTFWZJHWEX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|