C27H30F2N6O — CID 139801458
4-amino-N-[2-[4-(3,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide (PubChem CID 139801458) has the molecular formula C27H30F2N6O and a molecular weight of 492.57 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(3,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide.
| Compound Name | 4-amino-N-[2-[4-(3,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide |
|---|---|
| PubChem CID | 139801458 |
| Molecular Formula | C27H30F2N6O |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 4-amino-N-[2-[4-(3,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide |
| SMILES | Nc1ccc(C(=O)N(CCN2CCN(c3ccc(F)c(F)c3)CC2)c2ncnc3c2CCCC3)cc1 |
| InChI | InChI=1S/C27H30F2N6O/c28-23-10-9-21(17-24(23)29)34-14-11-33(12-15-34)13-16-35(27(36)19-5-7-20(30)8-6-19)26-22-3-1-2-4-25(22)31-18-32-26/h5-10,17-18H,1-4,11-16,30H2 |
| InChIKey | DTKFSJJJDWFOLS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|