C27H31ClN6O — CID 139801446
4-amino-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide (PubChem CID 139801446) has the molecular formula C27H31ClN6O and a molecular weight of 491.04 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide.
| Compound Name | 4-amino-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide |
|---|---|
| PubChem CID | 139801446 |
| Molecular Formula | C27H31ClN6O |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 4-amino-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydroquinazolin-4-yl)benzamide |
| SMILES | Nc1ccc(C(=O)N(CCN2CCN(c3ccccc3Cl)CC2)c2ncnc3c2CCCC3)cc1 |
| InChI | InChI=1S/C27H31ClN6O/c28-23-6-2-4-8-25(23)33-16-13-32(14-17-33)15-18-34(27(35)20-9-11-21(29)12-10-20)26-22-5-1-3-7-24(22)30-19-31-26/h2,4,6,8-12,19H,1,3,5,7,13-18,29H2 |
| InChIKey | BCWLPBFBZGEOOA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|